4-(4-Fluorophenoxy)aniline
Catalog No: FT-0678063
CAS No: 36160-82-4
- Chemical Name: 4-(4-Fluorophenoxy)aniline
- Molecular Formula: C12H10FNO
- Molecular Weight: 203.21
- InChI Key: SMWBBLSINLFYAB-UHFFFAOYSA-N
- InChI: InChI=1S/C12H10FNO/c13-9-1-5-11(6-2-9)15-12-7-3-10(14)4-8-12/h1-8H,14H2
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Product_Name: | 4-(4-Fluorophenoxy)aniline |
|---|---|
| Bolling_Point: | 317.2±27.0 °C at 760 mmHg |
| MF: | C12H10FNO |
| Symbol: | GHS05, GHS07 |
| Melting_Point: | 58.9-60.4ºC |
| CAS: | 36160-82-4 |
| Density: | 1.2±0.1 g/cm3 |
| FW: | 203.212 |
| Flash_Point: | 145.7±23.7 °C |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
|---|---|
| Exact_Mass: | 203.074646 |
| Refractive_Index: | 1.600 |
| LogP: | 2.65 |
| Bolling_Point: | 317.2±27.0 °C at 760 mmHg |
| Density: | 1.2±0.1 g/cm3 |
| MF: | C12H10FNO |
| PSA: | 35.25000 |
| FW: | 203.212 |
| Flash_Point: | 145.7±23.7 °C |
| Melting_Point: | 58.9-60.4ºC |
| Risk_Statements(EU): | R22 |
|---|---|
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| Safety_Statements: | H302-H315-H318-H335 |
| HS_Code: | 2922299090 |
| Warning_Statement: | P261-P280-P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| Symbol: | GHS05, GHS07 |
| Hazard_Codes: | Xn: Harmful;Xi: Irritant; |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)